About (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride
(2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride (PubChem CID 122236264) has the molecular formula C4H6Cl2N2O
and a molecular weight of 169.01 g/mol. Its IUPAC name is (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride.
Analyze (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride?
The IUPAC name of (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride (CID 122236264) is (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride.
What is the SMILES notation for (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride?
The canonical SMILES for (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride is Cl.NCc1coc(Cl)n1.
What is the InChIKey of (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride?
The InChIKey is UYPQVBNHWAXORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2O.ClH/c5-4-7-3(1-6)2-8-4;/h2H,1,6H2;1H.
What are the key properties of (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride?
(2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride has a molecular weight of 169.01 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,3-oxazol-4-yl)methanamine;hydrochloride is sourced from PubChem (CID 122236264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).