C3HClINO — CID 144649329
2-chloro-4-iodo-1,3-oxazole (PubChem CID 144649329) has the molecular formula C3HClINO and a molecular weight of 229.40 g/mol. Its IUPAC name is 2-chloro-4-iodo-1,3-oxazole.
| Compound Name | 2-chloro-4-iodo-1,3-oxazole |
|---|---|
| PubChem CID | 144649329 |
| Molecular Formula | C3HClINO |
| Molecular Weight | 229.40 g/mol |
| Exact Mass | 228.88 |
| IUPAC Name | 2-chloro-4-iodo-1,3-oxazole |
| SMILES | Clc1nc(I)co1 |
| InChI | InChI=1S/C3HClINO/c4-3-6-2(5)1-7-3/h1H |
| InChIKey | DCQQINQFZTWVNW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|