C9H5ClFNO — CID 89389386
2-chloro-4-(2-fluorophenyl)-1,3-oxazole (PubChem CID 89389386) has the molecular formula C9H5ClFNO and a molecular weight of 197.60 g/mol. Its IUPAC name is 2-chloro-4-(2-fluorophenyl)-1,3-oxazole.
| Compound Name | 2-chloro-4-(2-fluorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 89389386 |
| Molecular Formula | C9H5ClFNO |
| Molecular Weight | 197.60 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 2-chloro-4-(2-fluorophenyl)-1,3-oxazole |
| SMILES | Fc1ccccc1-c1coc(Cl)n1 |
| InChI | InChI=1S/C9H5ClFNO/c10-9-12-8(5-13-9)6-3-1-2-4-7(6)11/h1-5H |
| InChIKey | ASTONVSXPBQTEO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |