About 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene
2-chloro-4-phenyl-1,3-oxazole;fluorobenzene (PubChem CID 21408523) has the molecular formula C15H11ClFNO
and a molecular weight of 275.71 g/mol. Its IUPAC name is 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene.
Molecular Properties
| Compound Name | 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene |
| PubChem CID | 21408523 |
| Molecular Formula | C15H11ClFNO |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene |
| SMILES | Clc1nc(-c2ccccc2)co1.Fc1ccccc1 |
| InChI | InChI=1S/C9H6ClNO.C6H5F/c10-9-11-8(6-12-9)7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-6H;1-5H |
| InChIKey | UNIXHSKQJGFLPX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene?
The IUPAC name of 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene (CID 21408523) is 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene.
What is the SMILES notation for 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene?
The canonical SMILES for 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene is Clc1nc(-c2ccccc2)co1.Fc1ccccc1.
What is the InChIKey of 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene?
The InChIKey is UNIXHSKQJGFLPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO.C6H5F/c10-9-11-8(6-12-9)7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-6H;1-5H.
What are the key properties of 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene?
2-chloro-4-phenyl-1,3-oxazole;fluorobenzene has a molecular weight of 275.71 g/mol, XLogP of 4.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-phenyl-1,3-oxazole;fluorobenzene is sourced from PubChem (CID 21408523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).