C12H15NO2S — CID 82439271
[4-tert-butyl-2-(furan-2-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 82439271) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is [4-tert-butyl-2-(furan-2-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-tert-butyl-2-(furan-2-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 82439271 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | [4-tert-butyl-2-(furan-2-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | CC(C)(C)c1nc(-c2ccco2)sc1CO |
| InChI | InChI=1S/C12H15NO2S/c1-12(2,3)10-9(7-14)16-11(13-10)8-5-4-6-15-8/h4-6,14H,7H2,1-3H3 |
| InChIKey | NBZHMSLJGSVSLH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |