C12H16N2OS — CID 82439289
[4-tert-butyl-2-(furan-2-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 82439289) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is [4-tert-butyl-2-(furan-2-yl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [4-tert-butyl-2-(furan-2-yl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82439289 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [4-tert-butyl-2-(furan-2-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | CC(C)(C)c1nc(-c2ccco2)sc1CN |
| InChI | InChI=1S/C12H16N2OS/c1-12(2,3)10-9(7-13)16-11(14-10)8-5-4-6-15-8/h4-6H,7,13H2,1-3H3 |
| InChIKey | VFRZFCOOHNQFSZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |