C10H12N2O2 — CID 115083602
1-[2-(furan-2-yl)-1,3-oxazol-4-yl]propan-2-amine (PubChem CID 115083602) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-1,3-oxazol-4-yl]propan-2-amine.
| Compound Name | 1-[2-(furan-2-yl)-1,3-oxazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 115083602 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-[2-(furan-2-yl)-1,3-oxazol-4-yl]propan-2-amine |
| SMILES | CC(N)Cc1coc(-c2ccco2)n1 |
| InChI | InChI=1S/C10H12N2O2/c1-7(11)5-8-6-14-10(12-8)9-3-2-4-13-9/h2-4,6-7H,5,11H2,1H3 |
| InChIKey | HVZYCZWUZLWEBJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |