C17H19F3N4O2S — CID 167967615
2-[2-(1-methylpyrazol-4-yl)piperidin-1-yl]-2-oxo-N-[[4-(trifluoromethyl)thiophen-2-yl]methyl]acetamide (PubChem CID 167967615) has the molecular formula C17H19F3N4O2S and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[2-(1-methylpyrazol-4-yl)piperidin-1-yl]-2-oxo-N-[[4-(trifluoromethyl)thiophen-2-yl]methyl]acetamide.
| Compound Name | 2-[2-(1-methylpyrazol-4-yl)piperidin-1-yl]-2-oxo-N-[[4-(trifluoromethyl)thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 167967615 |
| Molecular Formula | C17H19F3N4O2S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-[2-(1-methylpyrazol-4-yl)piperidin-1-yl]-2-oxo-N-[[4-(trifluoromethyl)thiophen-2-yl]methyl]acetamide |
| SMILES | Cn1cc(C2CCCCN2C(=O)C(=O)NCc2cc(C(F)(F)F)cs2)cn1 |
| InChI | InChI=1S/C17H19F3N4O2S/c1-23-9-11(7-22-23)14-4-2-3-5-24(14)16(26)15(25)21-8-13-6-12(10-27-13)17(18,19)20/h6-7,9-10,14H,2-5,8H2,1H3,(H,21,25) |
| InChIKey | OBKASGIZVRWPRL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|