C16H19N3O3 — CID 167968374
4-methyl-N-[(4-oxo-1H-quinolin-2-yl)methyl]morpholine-3-carboxamide (PubChem CID 167968374) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-methyl-N-[(4-oxo-1H-quinolin-2-yl)methyl]morpholine-3-carboxamide.
| Compound Name | 4-methyl-N-[(4-oxo-1H-quinolin-2-yl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 167968374 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-methyl-N-[(4-oxo-1H-quinolin-2-yl)methyl]morpholine-3-carboxamide |
| SMILES | CN1CCOCC1C(=O)NCc1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C16H19N3O3/c1-19-6-7-22-10-14(19)16(21)17-9-11-8-15(20)12-4-2-3-5-13(12)18-11/h2-5,8,14H,6-7,9-10H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | MKMUEOUGFDMYCC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |