C10H21N3O5S2 — CID 167973143
4-(2-methyloxolan-3-yl)sulfonyl-1,4-diazepane-1-sulfonamide (PubChem CID 167973143) has the molecular formula C10H21N3O5S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-(2-methyloxolan-3-yl)sulfonyl-1,4-diazepane-1-sulfonamide.
| Compound Name | 4-(2-methyloxolan-3-yl)sulfonyl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 167973143 |
| Molecular Formula | C10H21N3O5S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-(2-methyloxolan-3-yl)sulfonyl-1,4-diazepane-1-sulfonamide |
| SMILES | CC1OCCC1S(=O)(=O)N1CCCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C10H21N3O5S2/c1-9-10(3-8-18-9)19(14,15)12-4-2-5-13(7-6-12)20(11,16)17/h9-10H,2-8H2,1H3,(H2,11,16,17) |
| InChIKey | RQCGVNFZSANADC-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |