C10H19N7O — CID 167973623
1-[(1-ethylpyrrolidin-3-yl)methyl]-3-(2-methyltetrazol-5-yl)urea (PubChem CID 167973623) has the molecular formula C10H19N7O and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-(2-methyltetrazol-5-yl)urea.
| Compound Name | 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-(2-methyltetrazol-5-yl)urea |
|---|---|
| PubChem CID | 167973623 |
| Molecular Formula | C10H19N7O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-(2-methyltetrazol-5-yl)urea |
| SMILES | CCN1CCC(CNC(=O)Nc2nnn(C)n2)C1 |
| InChI | InChI=1S/C10H19N7O/c1-3-17-5-4-8(7-17)6-11-10(18)12-9-13-15-16(2)14-9/h8H,3-7H2,1-2H3,(H2,11,12,14,18) |
| InChIKey | RAMZWOBAMYELRI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |