C16H23N5O — CID 167974128
N-[(2-ethylpyrazol-3-yl)methyl]-1-[3-[(3S)-pyrrolidin-3-yl]oxy-4-pyridinyl]methanamine (PubChem CID 167974128) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)methyl]-1-[3-[(3S)-pyrrolidin-3-yl]oxy-4-pyridinyl]methanamine.
| Compound Name | N-[(2-ethylpyrazol-3-yl)methyl]-1-[3-[(3S)-pyrrolidin-3-yl]oxy-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 167974128 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)methyl]-1-[3-[(3S)-pyrrolidin-3-yl]oxy-4-pyridinyl]methanamine |
| SMILES | CCn1nccc1CNCc1ccncc1O[C@H]1CCNC1 |
| InChI | InChI=1S/C16H23N5O/c1-2-21-14(4-8-20-21)10-19-9-13-3-6-18-12-16(13)22-15-5-7-17-11-15/h3-4,6,8,12,15,17,19H,2,5,7,9-11H2,1H3/t15-/m0/s1 |
| InChIKey | RKTQYYHYNXCTQX-HNNXBMFYSA-N |
| XLogP | 1.33 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |