C20H21N5O3S — CID 167974459
2-oxo-2-[4-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 167974459) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-oxo-2-[4-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-oxo-2-[4-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 167974459 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-oxo-2-[4-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | NC(=O)C(=O)N1CCCN(Cc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C20H21N5O3S/c21-17(26)20(28)25-8-4-7-24(9-10-25)11-15-22-18(27)16-14(12-29-19(16)23-15)13-5-2-1-3-6-13/h1-3,5-6,12H,4,7-11H2,(H2,21,26)(H,22,23,27) |
| InChIKey | CIYRYBLPWJVGFE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|