C16H17FN4S — CID 167975107
6-fluoro-3-[5-methyl-2-(thian-4-yl)-1,2,4-triazol-3-yl]-1H-indole (PubChem CID 167975107) has the molecular formula C16H17FN4S and a molecular weight of 316.40 g/mol. Its IUPAC name is 6-fluoro-3-[5-methyl-2-(thian-4-yl)-1,2,4-triazol-3-yl]-1H-indole.
| Compound Name | 6-fluoro-3-[5-methyl-2-(thian-4-yl)-1,2,4-triazol-3-yl]-1H-indole |
|---|---|
| PubChem CID | 167975107 |
| Molecular Formula | C16H17FN4S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 6-fluoro-3-[5-methyl-2-(thian-4-yl)-1,2,4-triazol-3-yl]-1H-indole |
| SMILES | Cc1nc(-c2c[nH]c3cc(F)ccc23)n(C2CCSCC2)n1 |
| InChI | InChI=1S/C16H17FN4S/c1-10-19-16(21(20-10)12-4-6-22-7-5-12)14-9-18-15-8-11(17)2-3-13(14)15/h2-3,8-9,12,18H,4-7H2,1H3 |
| InChIKey | SWXTXGZTWBBHLA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |