C20H17N3O5S2 — CID 16797541
(4-carbamoyl-2-nitrophenyl)methyl 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate (PubChem CID 16797541) has the molecular formula C20H17N3O5S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is (4-carbamoyl-2-nitrophenyl)methyl 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate.
| Compound Name | (4-carbamoyl-2-nitrophenyl)methyl 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 16797541 |
| Molecular Formula | C20H17N3O5S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | (4-carbamoyl-2-nitrophenyl)methyl 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate |
| SMILES | Cc1nc(CSc2ccccc2C(=O)OCc2ccc(C(N)=O)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C20H17N3O5S2/c1-12-22-15(10-29-12)11-30-18-5-3-2-4-16(18)20(25)28-9-14-7-6-13(19(21)24)8-17(14)23(26)27/h2-8,10H,9,11H2,1H3,(H2,21,24) |
| InChIKey | YVKXOTZIUGWPEU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|