C20H22KNO4 — CID 167977502
potassium 2-(hydroxymethyl)-5-[[2-methyl-2-(3-methylphenyl)propyl]carbamoyl]benzoate (PubChem CID 167977502) has the molecular formula C20H22KNO4 and a molecular weight of 379.50 g/mol. Its IUPAC name is potassium 2-(hydroxymethyl)-5-[[2-methyl-2-(3-methylphenyl)propyl]carbamoyl]benzoate.
| Compound Name | potassium 2-(hydroxymethyl)-5-[[2-methyl-2-(3-methylphenyl)propyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 167977502 |
| Molecular Formula | C20H22KNO4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | potassium 2-(hydroxymethyl)-5-[[2-methyl-2-(3-methylphenyl)propyl]carbamoyl]benzoate |
| SMILES | Cc1cccc(C(C)(C)CNC(=O)c2ccc(CO)c(C(=O)[O-])c2)c1.[K+] |
| InChI | InChI=1S/C20H23NO4.K/c1-13-5-4-6-16(9-13)20(2,3)12-21-18(23)14-7-8-15(11-22)17(10-14)19(24)25;/h4-10,22H,11-12H2,1-3H3,(H,21,23)(H,24,25);/q;+1/p-1 |
| InChIKey | GBGYTMGLGPMGPG-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |