C15H13N3O7S — CID 16797909
2-[[2-[(5Z)-5-[(4-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]propanoic acid (PubChem CID 16797909) has the molecular formula C15H13N3O7S and a molecular weight of 379.35 g/mol. Its IUPAC name is 2-[[2-[(5Z)-5-[(4-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[(5Z)-5-[(4-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 16797909 |
| Molecular Formula | C15H13N3O7S |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 2-[[2-[(5Z)-5-[(4-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)CN1C(=O)S/C(=C\c2ccc([N+](=O)[O-])cc2)C1=O)C(=O)O |
| InChI | InChI=1S/C15H13N3O7S/c1-8(14(21)22)16-12(19)7-17-13(20)11(26-15(17)23)6-9-2-4-10(5-3-9)18(24)25/h2-6,8H,7H2,1H3,(H,16,19)(H,21,22)/b11-6- |
| InChIKey | QEYOGKONSCFNQS-WDZFZDKYSA-N |
| XLogP | 1.22 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|