C17H19N3O4S2 — CID 6385963
2-[[2-[(5E)-5-[[4-(dimethylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]propanoic acid (PubChem CID 6385963) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[[2-[(5E)-5-[[4-(dimethylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[(5E)-5-[[4-(dimethylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 6385963 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-[[2-[(5E)-5-[[4-(dimethylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)CN1C(=O)/C(=C\c2ccc(N(C)C)cc2)SC1=S)C(=O)O |
| InChI | InChI=1S/C17H19N3O4S2/c1-10(16(23)24)18-14(21)9-20-15(22)13(26-17(20)25)8-11-4-6-12(7-5-11)19(2)3/h4-8,10H,9H2,1-3H3,(H,18,21)(H,23,24)/b13-8+ |
| InChIKey | SXMJTYIMLLNZSQ-MDWZMJQESA-N |
| XLogP | 1.54 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|