C18H20N2O5 — CID 167980927
benzyl 2-hydroxy-3-[[2-hydroxy-2-(3-methyl-2-pyridinyl)acetyl]amino]propanoate (PubChem CID 167980927) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is benzyl 2-hydroxy-3-[[2-hydroxy-2-(3-methyl-2-pyridinyl)acetyl]amino]propanoate.
| Compound Name | benzyl 2-hydroxy-3-[[2-hydroxy-2-(3-methyl-2-pyridinyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 167980927 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | benzyl 2-hydroxy-3-[[2-hydroxy-2-(3-methyl-2-pyridinyl)acetyl]amino]propanoate |
| SMILES | Cc1cccnc1C(O)C(=O)NCC(O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O5/c1-12-6-5-9-19-15(12)16(22)17(23)20-10-14(21)18(24)25-11-13-7-3-2-4-8-13/h2-9,14,16,21-22H,10-11H2,1H3,(H,20,23) |
| InChIKey | LVDYAGCXJDILLW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |