C18H22N4O2 — CID 167981657
[5-[(4,6-dimethylpyrimidin-2-yl)amino]-2-hydroxyphenyl]-[(3S)-3-methylpyrrolidin-1-yl]methanone (PubChem CID 167981657) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is [5-[(4,6-dimethylpyrimidin-2-yl)amino]-2-hydroxyphenyl]-[(3S)-3-methylpyrrolidin-1-yl]methanone.
| Compound Name | [5-[(4,6-dimethylpyrimidin-2-yl)amino]-2-hydroxyphenyl]-[(3S)-3-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 167981657 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [5-[(4,6-dimethylpyrimidin-2-yl)amino]-2-hydroxyphenyl]-[(3S)-3-methylpyrrolidin-1-yl]methanone |
| SMILES | Cc1cc(C)nc(Nc2ccc(O)c(C(=O)N3CC[C@H](C)C3)c2)n1 |
| InChI | InChI=1S/C18H22N4O2/c1-11-6-7-22(10-11)17(24)15-9-14(4-5-16(15)23)21-18-19-12(2)8-13(3)20-18/h4-5,8-9,11,23H,6-7,10H2,1-3H3,(H,19,20,21)/t11-/m0/s1 |
| InChIKey | KGUPAVLPSHPVJE-NSHDSACASA-N |
| XLogP | 3.02 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|