C8H9N7O2 — CID 167982197
5-[(2-methyltetrazol-5-yl)methylamino]pyrazine-2-carboxylic acid (PubChem CID 167982197) has the molecular formula C8H9N7O2 and a molecular weight of 235.21 g/mol. Its IUPAC name is 5-[(2-methyltetrazol-5-yl)methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[(2-methyltetrazol-5-yl)methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 167982197 |
| Molecular Formula | C8H9N7O2 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-[(2-methyltetrazol-5-yl)methylamino]pyrazine-2-carboxylic acid |
| SMILES | Cn1nnc(CNc2cnc(C(=O)O)cn2)n1 |
| InChI | InChI=1S/C8H9N7O2/c1-15-13-7(12-14-15)4-11-6-3-9-5(2-10-6)8(16)17/h2-3H,4H2,1H3,(H,10,11)(H,16,17) |
| InChIKey | NBTLULYOHKLKQW-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |