C16H20N4O4S — CID 122049013
5-[[4-(2-methylpropylsulfamoyl)phenyl]methylamino]pyrazine-2-carboxylic acid (PubChem CID 122049013) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is 5-[[4-(2-methylpropylsulfamoyl)phenyl]methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[4-(2-methylpropylsulfamoyl)phenyl]methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122049013 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 5-[[4-(2-methylpropylsulfamoyl)phenyl]methylamino]pyrazine-2-carboxylic acid |
| SMILES | CC(C)CNS(=O)(=O)c1ccc(CNc2cnc(C(=O)O)cn2)cc1 |
| InChI | InChI=1S/C16H20N4O4S/c1-11(2)7-20-25(23,24)13-5-3-12(4-6-13)8-18-15-10-17-14(9-19-15)16(21)22/h3-6,9-11,20H,7-8H2,1-2H3,(H,18,19)(H,21,22) |
| InChIKey | MLFZDRODMJXSEI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |