C16H22N4O2S — CID 75522952
N-(2-methylpropyl)-4-[[(6-methylpyrazin-2-yl)amino]methyl]benzenesulfonamide (PubChem CID 75522952) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is N-(2-methylpropyl)-4-[[(6-methylpyrazin-2-yl)amino]methyl]benzenesulfonamide.
| Compound Name | N-(2-methylpropyl)-4-[[(6-methylpyrazin-2-yl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75522952 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-(2-methylpropyl)-4-[[(6-methylpyrazin-2-yl)amino]methyl]benzenesulfonamide |
| SMILES | Cc1cncc(NCc2ccc(S(=O)(=O)NCC(C)C)cc2)n1 |
| InChI | InChI=1S/C16H22N4O2S/c1-12(2)8-19-23(21,22)15-6-4-14(5-7-15)10-18-16-11-17-9-13(3)20-16/h4-7,9,11-12,19H,8,10H2,1-3H3,(H,18,20) |
| InChIKey | UBQKQMFOTNZANA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |