C18H25NO4 — CID 167982576
4-[2-[(4-ethyl-4-hydroxycyclohexyl)amino]-2-oxoethyl]-3-methylbenzoic acid (PubChem CID 167982576) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-[2-[(4-ethyl-4-hydroxycyclohexyl)amino]-2-oxoethyl]-3-methylbenzoic acid.
| Compound Name | 4-[2-[(4-ethyl-4-hydroxycyclohexyl)amino]-2-oxoethyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 167982576 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-[2-[(4-ethyl-4-hydroxycyclohexyl)amino]-2-oxoethyl]-3-methylbenzoic acid |
| SMILES | CCC1(O)CCC(NC(=O)Cc2ccc(C(=O)O)cc2C)CC1 |
| InChI | InChI=1S/C18H25NO4/c1-3-18(23)8-6-15(7-9-18)19-16(20)11-13-4-5-14(17(21)22)10-12(13)2/h4-5,10,15,23H,3,6-9,11H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | IRGICQZSOWDFHO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |