C13H7F3N4O — CID 167983417
N-(6-cyano-3-pyridinyl)-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 167983417) has the molecular formula C13H7F3N4O and a molecular weight of 292.22 g/mol. Its IUPAC name is N-(6-cyano-3-pyridinyl)-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(6-cyano-3-pyridinyl)-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167983417 |
| Molecular Formula | C13H7F3N4O |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-(6-cyano-3-pyridinyl)-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cccc(C(F)(F)F)n2)cn1 |
| InChI | InChI=1S/C13H7F3N4O/c14-13(15,16)11-3-1-2-10(20-11)12(21)19-9-5-4-8(6-17)18-7-9/h1-5,7H,(H,19,21) |
| InChIKey | CPSBAJSQUAULCQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |