About 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid
3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 167983903) has the molecular formula C12H13FN2O6S
and a molecular weight of 332.31 g/mol. Its IUPAC name is 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid |
| PubChem CID | 167983903 |
| Molecular Formula | C12H13FN2O6S |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)NS(=O)(=O)c1cc2oc(=O)[nH]c2cc1F |
| InChI | InChI=1S/C12H13FN2O6S/c1-12(2,5-10(16)17)15-22(19,20)9-4-8-7(3-6(9)13)14-11(18)21-8/h3-4,15H,5H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | YVSVLEHWKOYJDF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid?
The IUPAC name of 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid (CID 167983903) is 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid.
What is the SMILES notation for 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid?
The canonical SMILES for 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid is CC(C)(CC(=O)O)NS(=O)(=O)c1cc2oc(=O)[nH]c2cc1F.
What is the InChIKey of 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid?
The InChIKey is YVSVLEHWKOYJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O6S/c1-12(2,5-10(16)17)15-22(19,20)9-4-8-7(3-6(9)13)14-11(18)21-8/h3-4,15H,5H2,1-2H3,(H,14,18)(H,16,17).
What are the key properties of 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid?
3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid has a molecular weight of 332.31 g/mol, XLogP of 0.79, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-fluoro-2-oxo-3H-1,3-benzoxazol-6-yl)sulfonylamino]-3-methylbutanoic acid is sourced from PubChem (CID 167983903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).