C12H16ClNO5S — CID 138044228
3-[(2-chloro-5-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 138044228) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is 3-[(2-chloro-5-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | 3-[(2-chloro-5-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 138044228 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 3-[(2-chloro-5-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | COc1ccc(Cl)c(S(=O)(=O)NC(C)(C)CC(=O)O)c1 |
| InChI | InChI=1S/C12H16ClNO5S/c1-12(2,7-11(15)16)14-20(17,18)10-6-8(19-3)4-5-9(10)13/h4-6,14H,7H2,1-3H3,(H,15,16) |
| InChIKey | MNKKEYLGFSLORA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |