C11H16N2O6S2 — CID 64670981
3-methyl-3-[(3-sulfamoylphenyl)sulfonylamino]butanoic acid (PubChem CID 64670981) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-methyl-3-[(3-sulfamoylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 3-methyl-3-[(3-sulfamoylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 64670981 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 3-methyl-3-[(3-sulfamoylphenyl)sulfonylamino]butanoic acid |
| SMILES | CC(C)(CC(=O)O)NS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H16N2O6S2/c1-11(2,7-10(14)15)13-21(18,19)9-5-3-4-8(6-9)20(12,16)17/h3-6,13H,7H2,1-2H3,(H,14,15)(H2,12,16,17) |
| InChIKey | KOIIVPKLIIHPJF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |