About oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate
oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate (PubChem CID 167984115) has the molecular formula C18H22N4O3
and a molecular weight of 342.40 g/mol. Its IUPAC name is oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate.
Molecular Properties
| Compound Name | oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate |
| PubChem CID | 167984115 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate |
| SMILES | CN(C(=O)OC1COC1)C1CCN(c2ncnc3ccccc23)CC1 |
| InChI | InChI=1S/C18H22N4O3/c1-21(18(23)25-14-10-24-11-14)13-6-8-22(9-7-13)17-15-4-2-3-5-16(15)19-12-20-17/h2-5,12-14H,6-11H2,1H3 |
| InChIKey | ARZCFDYGKNRXBL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate?
The IUPAC name of oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate (CID 167984115) is oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate.
What is the SMILES notation for oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate?
The canonical SMILES for oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate is CN(C(=O)OC1COC1)C1CCN(c2ncnc3ccccc23)CC1.
What is the InChIKey of oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate?
The InChIKey is ARZCFDYGKNRXBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O3/c1-21(18(23)25-14-10-24-11-14)13-6-8-22(9-7-13)17-15-4-2-3-5-16(15)19-12-20-17/h2-5,12-14H,6-11H2,1H3.
What are the key properties of oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate?
oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate has a molecular weight of 342.40 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-3-yl N-methyl-N-(1-quinazolin-4-ylpiperidin-4-yl)carbamate is sourced from PubChem (CID 167984115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).