C22H24N4O3 — CID 167986253
6-N-[3-(1,2,3,3a,4,5,6,6a-octahydropentalene-2-carbonylamino)phenyl]pyridine-2,6-dicarboxamide (PubChem CID 167986253) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 6-N-[3-(1,2,3,3a,4,5,6,6a-octahydropentalene-2-carbonylamino)phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-[3-(1,2,3,3a,4,5,6,6a-octahydropentalene-2-carbonylamino)phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 167986253 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 6-N-[3-(1,2,3,3a,4,5,6,6a-octahydropentalene-2-carbonylamino)phenyl]pyridine-2,6-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(=O)Nc2cccc(NC(=O)C3CC4CCCC4C3)c2)n1 |
| InChI | InChI=1S/C22H24N4O3/c23-20(27)18-8-3-9-19(26-18)22(29)25-17-7-2-6-16(12-17)24-21(28)15-10-13-4-1-5-14(13)11-15/h2-3,6-9,12-15H,1,4-5,10-11H2,(H2,23,27)(H,24,28)(H,25,29) |
| InChIKey | DMYVPGOPXAOSDW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |