C21H25Cl2F3N4O4S — CID 167986655
3,5-dichloro-4-[[(1S,5R)-1,5-dimethyl-3-azabicyclo[3.2.0]heptan-3-yl]sulfonyl]-N-(2-imidazol-1-ylethyl)aniline;2,2,2-trifluoroacetic acid (PubChem CID 167986655) has the molecular formula C21H25Cl2F3N4O4S and a molecular weight of 557.42 g/mol. Its IUPAC name is 3,5-dichloro-4-[[(1S,5R)-1,5-dimethyl-3-azabicyclo[3.2.0]heptan-3-yl]sulfonyl]-N-(2-imidazol-1-ylethyl)aniline;2,2,2-trifluoroacetic acid.
| Compound Name | 3,5-dichloro-4-[[(1S,5R)-1,5-dimethyl-3-azabicyclo[3.2.0]heptan-3-yl]sulfonyl]-N-(2-imidazol-1-ylethyl)aniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167986655 |
| Molecular Formula | C21H25Cl2F3N4O4S |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | 3,5-dichloro-4-[[(1S,5R)-1,5-dimethyl-3-azabicyclo[3.2.0]heptan-3-yl]sulfonyl]-N-(2-imidazol-1-ylethyl)aniline;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@]12CC[C@]1(C)CN(S(=O)(=O)c1c(Cl)cc(NCCn3ccnc3)cc1Cl)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24Cl2N4O2S.C2HF3O2/c1-18-3-4-19(18,2)12-25(11-18)28(26,27)17-15(20)9-14(10-16(17)21)23-6-8-24-7-5-22-13-24;3-2(4,5)1(6)7/h5,7,9-10,13,23H,3-4,6,8,11-12H2,1-2H3;(H,6,7)/t18-,19+; |
| InChIKey | AMFQOXNDWGGOMT-AQDIUKAZSA-N |
| XLogP | 4.75 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |