C20H20N4O6S — CID 167989719
N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-5-methoxypyridine-3-sulfonamide (PubChem CID 167989719) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-5-methoxypyridine-3-sulfonamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-5-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 167989719 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-5-methoxypyridine-3-sulfonamide |
| SMILES | COc1cncc(S(=O)(=O)NCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)c1 |
| InChI | InChI=1S/C20H20N4O6S/c1-30-14-7-15(10-21-9-14)31(28,29)22-8-12-2-3-13-11-24(20(27)16(13)6-12)17-4-5-18(25)23-19(17)26/h2-3,6-7,9-10,17,22H,4-5,8,11H2,1H3,(H,23,25,26) |
| InChIKey | VHCOVMIWYHNLEN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|