C20H23N5O5S — CID 167786630
N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-1-ethyl-3-methylpyrazole-4-sulfonamide (PubChem CID 167786630) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-1-ethyl-3-methylpyrazole-4-sulfonamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-1-ethyl-3-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 167786630 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-1-ethyl-3-methylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)c(C)n1 |
| InChI | InChI=1S/C20H23N5O5S/c1-3-24-11-17(12(2)23-24)31(29,30)21-9-13-4-5-14-10-25(20(28)15(14)8-13)16-6-7-18(26)22-19(16)27/h4-5,8,11,16,21H,3,6-7,9-10H2,1-2H3,(H,22,26,27) |
| InChIKey | MMUBQUQJHBVWDZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|