C14H20BrN3O2 — CID 167991177
2-[2-(2-aminoethyl)morpholin-4-yl]-2-(3-bromophenyl)acetamide (PubChem CID 167991177) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is 2-[2-(2-aminoethyl)morpholin-4-yl]-2-(3-bromophenyl)acetamide.
| Compound Name | 2-[2-(2-aminoethyl)morpholin-4-yl]-2-(3-bromophenyl)acetamide |
|---|---|
| PubChem CID | 167991177 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-[2-(2-aminoethyl)morpholin-4-yl]-2-(3-bromophenyl)acetamide |
| SMILES | NCCC1CN(C(C(N)=O)c2cccc(Br)c2)CCO1 |
| InChI | InChI=1S/C14H20BrN3O2/c15-11-3-1-2-10(8-11)13(14(17)19)18-6-7-20-12(9-18)4-5-16/h1-3,8,12-13H,4-7,9,16H2,(H2,17,19) |
| InChIKey | OTXYUOIDEPYZPK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |