C21H17N3O2 — CID 167993084
2-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]quinoline-8-carboxamide (PubChem CID 167993084) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]quinoline-8-carboxamide.
| Compound Name | 2-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 167993084 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]quinoline-8-carboxamide |
| SMILES | Cc1ccc2cccc(C(=O)NCc3cc(=O)[nH]c4ccccc34)c2n1 |
| InChI | InChI=1S/C21H17N3O2/c1-13-9-10-14-5-4-7-17(20(14)23-13)21(26)22-12-15-11-19(25)24-18-8-3-2-6-16(15)18/h2-11H,12H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | ZIOLWJFUECNBNO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |