C36H38N4O2 — CID 167993424
2-N,9-N-diethyl-2-N,9-N-bis(2,4,6-trimethylphenyl)-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 167993424) has the molecular formula C36H38N4O2 and a molecular weight of 558.73 g/mol. Its IUPAC name is 2-N,9-N-diethyl-2-N,9-N-bis(2,4,6-trimethylphenyl)-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 2-N,9-N-diethyl-2-N,9-N-bis(2,4,6-trimethylphenyl)-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 167993424 |
| Molecular Formula | C36H38N4O2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 2-N,9-N-diethyl-2-N,9-N-bis(2,4,6-trimethylphenyl)-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | CCN(C(=O)c1ccc2ccc3ccc(C(=O)N(CC)c4c(C)cc(C)cc4C)nc3c2n1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C36H38N4O2/c1-9-39(33-23(5)17-21(3)18-24(33)6)35(41)29-15-13-27-11-12-28-14-16-30(38-32(28)31(27)37-29)36(42)40(10-2)34-25(7)19-22(4)20-26(34)8/h11-20H,9-10H2,1-8H3 |
| InChIKey | MWXPKOLGMWIJOW-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|