C17H35N4O2+ — CID 167993657
[4-(1-decyltriazol-4-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]azanium (PubChem CID 167993657) has the molecular formula C17H35N4O2+ and a molecular weight of 327.49 g/mol. Its IUPAC name is [4-(1-decyltriazol-4-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]azanium.
| Compound Name | [4-(1-decyltriazol-4-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]azanium |
|---|---|
| PubChem CID | 167993657 |
| Molecular Formula | C17H35N4O2+ |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | [4-(1-decyltriazol-4-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]azanium |
| SMILES | CCCCCCCCCCn1cc(CCC([NH3+])(CO)CO)nn1 |
| InChI | InChI=1S/C17H34N4O2/c1-2-3-4-5-6-7-8-9-12-21-13-16(19-20-21)10-11-17(18,14-22)15-23/h13,22-23H,2-12,14-15,18H2,1H3/p+1 |
| InChIKey | LTSWFNFQPMMTIG-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|