C17H35N4O5P — CID 175672957
[2-amino-4-(1-decyltriazol-4-yl)-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 175672957) has the molecular formula C17H35N4O5P and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-amino-4-(1-decyltriazol-4-yl)-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-(1-decyltriazol-4-yl)-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 175672957 |
| Molecular Formula | C17H35N4O5P |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [2-amino-4-(1-decyltriazol-4-yl)-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | CCCCCCCCCCn1cc(CCC(N)(CO)COP(=O)(O)O)nn1 |
| InChI | InChI=1S/C17H35N4O5P/c1-2-3-4-5-6-7-8-9-12-21-13-16(19-20-21)10-11-17(18,14-22)15-26-27(23,24)25/h13,22H,2-12,14-15,18H2,1H3,(H2,23,24,25) |
| InChIKey | CPYILCKEPPQNBR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|