C17H12N6O3S2 — CID 16801204
N-(4-nitrophenyl)-2-[(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)sulfanyl]acetamide (PubChem CID 16801204) has the molecular formula C17H12N6O3S2 and a molecular weight of 412.46 g/mol. Its IUPAC name is N-(4-nitrophenyl)-2-[(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)sulfanyl]acetamide.
| Compound Name | N-(4-nitrophenyl)-2-[(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 16801204 |
| Molecular Formula | C17H12N6O3S2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-(4-nitrophenyl)-2-[(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1ccc2nnc(-c3cccs3)n2n1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N6O3S2/c24-15(18-11-3-5-12(6-4-11)23(25)26)10-28-16-8-7-14-19-20-17(22(14)21-16)13-2-1-9-27-13/h1-9H,10H2,(H,18,24) |
| InChIKey | JMLYMDANJXFAJV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|