C19H13ClN6O3S — CID 43935477
2-[[3-(4-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 43935477) has the molecular formula C19H13ClN6O3S and a molecular weight of 440.87 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[3-(4-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 43935477 |
| Molecular Formula | C19H13ClN6O3S |
| Molecular Weight | 440.87 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CSc1ccc2nnc(-c3ccc(Cl)cc3)n2n1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13ClN6O3S/c20-13-3-1-12(2-4-13)19-23-22-16-9-10-18(24-25(16)19)30-11-17(27)21-14-5-7-15(8-6-14)26(28)29/h1-10H,11H2,(H,21,27) |
| InChIKey | DHYHZYXPLMPGAN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.87 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|