C20H18N8O5 — CID 16804359
[4-[3-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 16804359) has the molecular formula C20H18N8O5 and a molecular weight of 450.42 g/mol. Its IUPAC name is [4-[3-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [4-[3-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 16804359 |
| Molecular Formula | C20H18N8O5 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [4-[3-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | COc1cccc(-n2nnc3c(N4CCN(C(=O)c5ccc([N+](=O)[O-])o5)CC4)ncnc32)c1 |
| InChI | InChI=1S/C20H18N8O5/c1-32-14-4-2-3-13(11-14)27-19-17(23-24-27)18(21-12-22-19)25-7-9-26(10-8-25)20(29)15-5-6-16(33-15)28(30)31/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | UDKBNNSLCVQOHS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 145.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|