C21H16ClFN8O3 — CID 18588098
(5-chloro-2-nitrophenyl)-[4-[3-(3-fluorophenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]methanone (PubChem CID 18588098) has the molecular formula C21H16ClFN8O3 and a molecular weight of 482.86 g/mol. Its IUPAC name is (5-chloro-2-nitrophenyl)-[4-[3-(3-fluorophenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]methanone.
| Compound Name | (5-chloro-2-nitrophenyl)-[4-[3-(3-fluorophenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 18588098 |
| Molecular Formula | C21H16ClFN8O3 |
| Molecular Weight | 482.86 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | (5-chloro-2-nitrophenyl)-[4-[3-(3-fluorophenyl)triazolo[4,5-d]pyrimidin-7-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1[N+](=O)[O-])N1CCN(c2ncnc3c2nnn3-c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H16ClFN8O3/c22-13-4-5-17(31(33)34)16(10-13)21(32)29-8-6-28(7-9-29)19-18-20(25-12-24-19)30(27-26-18)15-3-1-2-14(23)11-15/h1-5,10-12H,6-9H2 |
| InChIKey | FNDHNDSLKBQDGK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|