C23H28BrN3O3S — CID 16806071
N,4-bis(4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine;hydrobromide (PubChem CID 16806071) has the molecular formula C23H28BrN3O3S and a molecular weight of 506.47 g/mol. Its IUPAC name is N,4-bis(4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | N,4-bis(4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 16806071 |
| Molecular Formula | C23H28BrN3O3S |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N,4-bis(4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.COc1ccc(/N=c2\scc(-c3ccc(OC)cc3)n2CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H27N3O3S.BrH/c1-27-20-7-3-18(4-8-20)22-17-30-23(24-19-5-9-21(28-2)10-6-19)26(22)12-11-25-13-15-29-16-14-25;/h3-10,17H,11-16H2,1-2H3;1H/b24-23-; |
| InChIKey | WKIVLLYEKMQFPX-DCXSSQDFSA-N |
| XLogP | 4.38 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|