C23H25N5O6S — CID 16807486
furan-2-yl-[4-[(6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 16807486) has the molecular formula C23H25N5O6S and a molecular weight of 499.55 g/mol. Its IUPAC name is furan-2-yl-[4-[(6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[(6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 16807486 |
| Molecular Formula | C23H25N5O6S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | furan-2-yl-[4-[(6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1cc(C(c2sc3ncnn3c2O)N2CCN(C(=O)c3ccco3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H25N5O6S/c1-31-16-11-14(12-17(32-2)19(16)33-3)18(20-22(30)28-23(35-20)24-13-25-28)26-6-8-27(9-7-26)21(29)15-5-4-10-34-15/h4-5,10-13,18,30H,6-9H2,1-3H3 |
| InChIKey | GZOWTIPTMJJUKE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |