C21H26N4O6S — CID 2144909
methyl 1-[(R)-(6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylate (PubChem CID 2144909) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is methyl 1-[(R)-(6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(R)-(6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2144909 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | methyl 1-[(R)-(6-hydroxy-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN([C@H](c2cc(OC)c(OC)c(OC)c2)c2sc3ncnn3c2O)CC1 |
| InChI | InChI=1S/C21H26N4O6S/c1-28-14-9-13(10-15(29-2)17(14)30-3)16(18-19(26)25-21(32-18)22-11-23-25)24-7-5-12(6-8-24)20(27)31-4/h9-12,16,26H,5-8H2,1-4H3/t16-/m1/s1 |
| InChIKey | IFLVUSXBINXJKJ-MRXNPFEDSA-N |
| XLogP | 2.50 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |