C25H34N4O3 — CID 16808144
2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-oxoacetamide (PubChem CID 16808144) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-oxoacetamide.
| Compound Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 16808144 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-oxoacetamide |
| SMILES | CCN1CCCC1CNC(=O)C(=O)c1cn(CC(=O)N2CCCCCC2)c2ccccc12 |
| InChI | InChI=1S/C25H34N4O3/c1-2-27-15-9-10-19(27)16-26-25(32)24(31)21-17-29(22-12-6-5-11-20(21)22)18-23(30)28-13-7-3-4-8-14-28/h5-6,11-12,17,19H,2-4,7-10,13-16,18H2,1H3,(H,26,32) |
| InChIKey | OMNPSGBVRINLBZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|