C27H29N3O5 — CID 41106474
2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-oxoacetamide (PubChem CID 41106474) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-oxoacetamide.
| Compound Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 41106474 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-oxoacetamide |
| SMILES | O=C(NC[C@H]1COc2ccccc2O1)C(=O)c1cn(CC(=O)N2CCCCCC2)c2ccccc12 |
| InChI | InChI=1S/C27H29N3O5/c31-25(29-13-7-1-2-8-14-29)17-30-16-21(20-9-3-4-10-22(20)30)26(32)27(33)28-15-19-18-34-23-11-5-6-12-24(23)35-19/h3-6,9-12,16,19H,1-2,7-8,13-15,17-18H2,(H,28,33)/t19-/m0/s1 |
| InChIKey | HJVRTNFBHLUJRZ-IBGZPJMESA-N |
| XLogP | 3.18 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|