C27H26N4O4 — CID 16812643
N-benzyl-2-[2-[4-(furan-2-carbonyl)piperazin-1-yl]quinolin-8-yl]oxyacetamide (PubChem CID 16812643) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-benzyl-2-[2-[4-(furan-2-carbonyl)piperazin-1-yl]quinolin-8-yl]oxyacetamide.
| Compound Name | N-benzyl-2-[2-[4-(furan-2-carbonyl)piperazin-1-yl]quinolin-8-yl]oxyacetamide |
|---|---|
| PubChem CID | 16812643 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-benzyl-2-[2-[4-(furan-2-carbonyl)piperazin-1-yl]quinolin-8-yl]oxyacetamide |
| SMILES | O=C(COc1cccc2ccc(N3CCN(C(=O)c4ccco4)CC3)nc12)NCc1ccccc1 |
| InChI | InChI=1S/C27H26N4O4/c32-25(28-18-20-6-2-1-3-7-20)19-35-22-9-4-8-21-11-12-24(29-26(21)22)30-13-15-31(16-14-30)27(33)23-10-5-17-34-23/h1-12,17H,13-16,18-19H2,(H,28,32) |
| InChIKey | DCWCKZHLQFXRJA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |