C16H16ClF2N3O — CID 16812988
N-(2-chloroethyl)-1-(3,4-difluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 16812988) has the molecular formula C16H16ClF2N3O and a molecular weight of 339.77 g/mol. Its IUPAC name is N-(2-chloroethyl)-1-(3,4-difluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-(2-chloroethyl)-1-(3,4-difluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 16812988 |
| Molecular Formula | C16H16ClF2N3O |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-(2-chloroethyl)-1-(3,4-difluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C(NCCCl)N1CCn2cccc2C1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16ClF2N3O/c17-5-6-20-16(23)22-9-8-21-7-1-2-14(21)15(22)11-3-4-12(18)13(19)10-11/h1-4,7,10,15H,5-6,8-9H2,(H,20,23) |
| InChIKey | LAHRDCOYDZYPIH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|