C16H17BrClN3O — CID 7589603
(1S)-1-(4-bromophenyl)-N-(2-chloroethyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 7589603) has the molecular formula C16H17BrClN3O and a molecular weight of 382.69 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)-N-(2-chloroethyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (1S)-1-(4-bromophenyl)-N-(2-chloroethyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 7589603 |
| Molecular Formula | C16H17BrClN3O |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | (1S)-1-(4-bromophenyl)-N-(2-chloroethyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C(NCCCl)N1CCn2cccc2[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H17BrClN3O/c17-13-5-3-12(4-6-13)15-14-2-1-9-20(14)10-11-21(15)16(22)19-8-7-18/h1-6,9,15H,7-8,10-11H2,(H,19,22)/t15-/m0/s1 |
| InChIKey | AMUUCKFIHIBTQI-HNNXBMFYSA-N |
| XLogP | 3.60 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|